Structure of PDB 5evb Chain A Binding Site BS03 |
|
|
Ligand ID | 3R9 |
InChI | InChI=1S/C7H11NO2S3/c9-7(10)4-2-12-6-3-13-5(1-11)8(4)6/h4-6,11H,1-3H2,(H,9,10)/t4-,5+,6-/m1/s1 |
InChIKey | ZTWVMVSSSBGFHH-NGJCXOISSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C1C(N2C(S1)CSC2CS)C(=O)O | CACTVS 3.385 | OC(=O)[C@H]1CS[C@@H]2CS[C@@H](CS)N12 | ACDLabs 12.01 | O=C(O)C1N2C(SCC2SC1)CS | CACTVS 3.385 | OC(=O)[CH]1CS[CH]2CS[CH](CS)N12 | OpenEye OEToolkits 1.7.6 | C1[C@@H](N2[C@H](S1)CS[C@H]2CS)C(=O)O |
|
Formula | C7 H11 N O2 S3 |
Name | (3S,5S,7aR)-5-(sulfanylmethyl)tetrahydro[1,3]thiazolo[4,3-b][1,3]thiazole-3-carboxylic acid |
ChEMBL | CHEMBL5267944 |
DrugBank | |
ZINC | ZINC000219081771
|
PDB chain | 5evb Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|