Structure of PDB 5d41 Chain A Binding Site BS03 |
|
|
Ligand ID | 57N |
InChI | InChI=1S/C19H15N3O2S/c23-17(21-19-20-10-11-25-19)16(13-6-2-1-3-7-13)22-12-14-8-4-5-9-15(14)18(22)24/h1-11,16H,12H2,(H,20,21,23)/t16-/m1/s1 |
InChIKey | PWRVRDCBFYLYFU-MRXNPFEDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | c1ccc(cc1)C(C(=O)Nc2nccs2)N3Cc4ccccc4C3=O | CACTVS 3.385 | O=C(Nc1sccn1)[CH](N2Cc3ccccc3C2=O)c4ccccc4 | CACTVS 3.385 | O=C(Nc1sccn1)[C@H](N2Cc3ccccc3C2=O)c4ccccc4 | OpenEye OEToolkits 1.9.2 | c1ccc(cc1)[C@H](C(=O)Nc2nccs2)N3Cc4ccccc4C3=O | ACDLabs 12.01 | c1(nccs1)NC(C(c2ccccc2)N4C(c3ccccc3C4)=O)=O |
|
Formula | C19 H15 N3 O2 S |
Name | (2R)-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)-2-phenyl-N-(1,3-thiazol-2-yl)acetamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000020531026
|
PDB chain | 5d41 Chain A Residue 1103
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|