Structure of PDB 4y79 Chain A Binding Site BS03 |
|
|
Ligand ID | 4O6 |
InChI | InChI=1S/C19H24ClN3O5S/c1-14(18(24)22-9-11-28-12-10-22)23-8-6-17(19(23)25)21-29(26,27)13-7-15-2-4-16(20)5-3-15/h2-5,7,13-14,17,21H,6,8-12H2,1H3/b13-7+/t14-,17-/m0/s1 |
InChIKey | DNCVZNVETAOAJO-PPYZAHLJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | C[C@@H](C(=O)N1CCOCC1)N2CC[C@@H](C2=O)NS(=O)(=O)/C=C/c3ccc(cc3)Cl | ACDLabs 12.01 | O=C(N1CCOCC1)C(N3C(=O)C(NS(=O)(=O)\C=C\c2ccc(Cl)cc2)CC3)C | CACTVS 3.385 | C[CH](N1CC[CH](N[S](=O)(=O)C=Cc2ccc(Cl)cc2)C1=O)C(=O)N3CCOCC3 | CACTVS 3.385 | C[C@H](N1CC[C@H](N[S](=O)(=O)\C=C\c2ccc(Cl)cc2)C1=O)C(=O)N3CCOCC3 | OpenEye OEToolkits 1.9.2 | CC(C(=O)N1CCOCC1)N2CCC(C2=O)NS(=O)(=O)C=Cc3ccc(cc3)Cl |
|
Formula | C19 H24 Cl N3 O5 S |
Name | (E)-2-(4-chlorophenyl)-N-{(3S)-1-[(2S)-1-(morpholin-4-yl)-1-oxopropan-2-yl]-2-oxopyrrolidin-3-yl}ethenesulfonamide; GTC000406 |
ChEMBL | CHEMBL223891 |
DrugBank | |
ZINC | ZINC000014965153
|
PDB chain | 4y79 Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|