Structure of PDB 4xe1 Chain A Binding Site BS03 |
|
|
Ligand ID | IL5 |
InChI | InChI=1S/C7H6N2O5S2/c8-15(11,12)4-1-2-5-6(3-4)16(13,14)9-7(5)10/h1-3H,(H,9,10)(H2,8,11,12) |
InChIKey | CRSHTYPFKXPVRE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | c1cc2c(cc1S(=O)(=O)N)S(=O)(=O)NC2=O | CACTVS 3.385 | N[S](=O)(=O)c1ccc2C(=O)N[S](=O)(=O)c2c1 | ACDLabs 12.01 | O=S(=O)(c1ccc2c(c1)S(=O)(=O)NC2=O)N |
|
Formula | C7 H6 N2 O5 S2 |
Name | 3-oxo-2,3-dihydro-1,2-benzothiazole-6-sulfonamide 1,1-dioxide |
ChEMBL | CHEMBL4456920 |
DrugBank | |
ZINC | ZINC000143422332
|
PDB chain | 4xe1 Chain A Residue 305
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|