Structure of PDB 4u45 Chain A Binding Site BS03 |
|
|
Ligand ID | 3DC |
InChI | InChI=1S/C14H11N7/c1-3-15-4-2-12(1)20-14-13-5-10(11-6-17-18-7-11)8-21(13)19-9-16-14/h1-9H,(H,17,18)(H,15,16,19,20) |
InChIKey | KFPMWFGUHKKDSW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | [nH]1cc(cn1)c2cn3ncnc(Nc4ccncc4)c3c2 | ACDLabs 12.01 | n3n2cc(c1cnnc1)cc2c(nc3)Nc4ccncc4 | OpenEye OEToolkits 1.9.2 | c1cnccc1Nc2c3cc(cn3ncn2)c4c[nH]nc4 |
|
Formula | C14 H11 N7 |
Name | 6-(1H-pyrazol-4-yl)-N-(pyridin-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208429
|
PDB chain | 4u45 Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|