Structure of PDB 4rmi Chain A Binding Site BS03 |
|
|
Ligand ID | 3TK |
InChI | InChI=1S/C18H18N4OS2/c1-12-8-13(2)21-18(20-12)24-11-16(23)22-17-19-10-15(25-17)9-14-6-4-3-5-7-14/h3-8,10H,9,11H2,1-2H3,(H,19,22,23) |
InChIKey | LHMBJRUBDQYYSV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1cc(C)nc(SCC(=O)Nc2sc(Cc3ccccc3)cn2)n1 | OpenEye OEToolkits 1.7.6 | Cc1cc(nc(n1)SCC(=O)Nc2ncc(s2)Cc3ccccc3)C | ACDLabs 12.01 | O=C(Nc1ncc(s1)Cc2ccccc2)CSc3nc(cc(n3)C)C |
|
Formula | C18 H18 N4 O S2 |
Name | N-(5-benzyl-1,3-thiazol-2-yl)-2-[(4,6-dimethylpyrimidin-2-yl)sulfanyl]acetamide |
ChEMBL | CHEMBL3769988 |
DrugBank | |
ZINC | ZINC000000818843
|
PDB chain | 4rmi Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|