Structure of PDB 4q3b Chain A Binding Site BS03 |
|
|
Ligand ID | 2YF |
InChI | InChI=1S/C12H21N3O3/c13-9(12(17)18)5-1-3-8-15-11(16)10-6-2-4-7-14-10/h7,9-10H,1-6,8,13H2,(H,15,16)(H,17,18)/t9-,10+/m0/s1 |
InChIKey | KRPZACZJBBRBIT-VHSXEESVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C1CC=NC(C1)C(=O)NCCCCC(C(=O)O)N | ACDLabs 12.01 | O=C(NCCCCC(C(=O)O)N)C1N=CCCC1 | OpenEye OEToolkits 1.7.6 | C1CC=N[C@H](C1)C(=O)NCCCC[C@@H](C(=O)O)N | CACTVS 3.385 | N[C@@H](CCCCNC(=O)[C@H]1CCCC=N1)C(O)=O | CACTVS 3.385 | N[CH](CCCCNC(=O)[CH]1CCCC=N1)C(O)=O |
|
Formula | C12 H21 N3 O3 |
Name | N~6~-[(2R)-2,3,4,5-tetrahydropyridin-2-ylcarbonyl]-L-lysine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208351
|
PDB chain | 4q3b Chain A Residue 904
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|