Structure of PDB 4njk Chain A Binding Site BS03 |
|
|
Ligand ID | 2KA |
InChI | InChI=1S/C7H6N4O3/c8-7-10-4-3(5(12)11-7)2(1-9-4)6(13)14/h1H,(H,13,14)(H4,8,9,10,11,12) |
InChIKey | XIUIRSLBMMTDSK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NC1=Nc2[nH]cc(C(O)=O)c2C(=O)N1 | ACDLabs 12.01 | O=C(O)c1cnc2N=C(N)NC(=O)c12 | OpenEye OEToolkits 1.7.6 | c1c(c2c([nH]1)N=C(NC2=O)N)C(=O)O |
|
Formula | C7 H6 N4 O3 |
Name | 2-amino-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000045800802
|
PDB chain | 4njk Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|