Structure of PDB 4nce Chain A Binding Site BS03 |
|
|
Ligand ID | 11H |
InChI | InChI=1S/C14H8O8S2/c15-13-9-3-1-7(23(17,18)19)5-11(9)14(16)10-4-2-8(6-12(10)13)24(20,21)22/h1-6H,(H,17,18,19)(H,20,21,22) |
InChIKey | MSSUFHMGCXOVBZ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=S(=O)(O)c3ccc2C(=O)c1c(ccc(c1)S(=O)(=O)O)C(=O)c2c3 | OpenEye OEToolkits 1.7.6 | c1cc2c(cc1S(=O)(=O)O)C(=O)c3ccc(cc3C2=O)S(=O)(=O)O | CACTVS 3.370 | O[S](=O)(=O)c1ccc2C(=O)c3cc(ccc3C(=O)c2c1)[S](O)(=O)=O |
|
Formula | C14 H8 O8 S2 |
Name | 9,10-dioxo-9,10-dihydroanthracene-2,6-disulfonic acid |
ChEMBL | CHEMBL3747842 |
DrugBank | |
ZINC | ZINC000003964228
|
PDB chain | 4nce Chain A Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|