Structure of PDB 4muq Chain A Binding Site BS03 |
|
|
Ligand ID | 2D8 |
InChI | InChI=1S/C6H14NO4P/c1-4(6(8)9)3-12(10,11)5(2)7/h4-5H,3,7H2,1-2H3,(H,8,9)(H,10,11)/t4-,5-/m0/s1 |
InChIKey | XXVGIEKADYFHOF-WHFBIAKZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[CH](N)[P](O)(=O)C[CH](C)C(O)=O | ACDLabs 12.01 | O=P(O)(C(N)C)CC(C(=O)O)C | CACTVS 3.385 | C[C@@H](N)[P](O)(=O)C[C@H](C)C(O)=O | OpenEye OEToolkits 1.7.6 | C[C@@H](CP(=O)([C@@H](C)N)O)C(=O)O | OpenEye OEToolkits 1.7.6 | CC(CP(=O)(C(C)N)O)C(=O)O |
|
Formula | C6 H14 N O4 P |
Name | (2R)-3-[(R)-[(1S)-1-aminoethyl](hydroxy)phosphoryl]-2-methylpropanoic acid |
ChEMBL | CHEMBL3350233 |
DrugBank | |
ZINC | ZINC000000024584
|
PDB chain | 4muq Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|