Structure of PDB 4mbf Chain A Binding Site BS03 |
|
|
Ligand ID | 2AW |
InChI | InChI=1S/C14H23NO9S/c1-14(25(22)23,12(13(20)21)15-7-4-8-16)9-24-11(19)6-3-2-5-10(17)18/h8,12,15H,2-7,9H2,1H3,(H,17,18)(H,20,21)(H,22,23)/t12-,14-/m0/s1 |
InChIKey | XJDMDWLRMVEPAR-JSGCOSHPSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(COC(=O)CCCCC(=O)O)(C(C(=O)O)NCCC=O)S(=O)O | ACDLabs 12.01 | O=C(OCC(S(=O)O)(C(C(=O)O)NCCC=O)C)CCCCC(=O)O | CACTVS 3.385 | C[C](COC(=O)CCCCC(O)=O)([CH](NCCC=O)C(O)=O)[S](O)=O | OpenEye OEToolkits 1.7.6 | C[C@](COC(=O)CCCCC(=O)O)([C@H](C(=O)O)NCCC=O)S(=O)O | CACTVS 3.385 | C[C@](COC(=O)CCCCC(O)=O)([C@@H](NCCC=O)C(O)=O)[S](O)=O |
|
Formula | C14 H23 N O9 S |
Name | 6-({(2R,3S)-3-carboxy-2-methyl-3-[(3-oxopropyl)amino]-2-sulfinopropyl}oxy)-6-oxohexanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208119
|
PDB chain | 4mbf Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|