Structure of PDB 4kvi Chain A Binding Site BS03 |
|
|
Ligand ID | 1SV |
InChI | InChI=1S/C13H21N/c1-10(2)11-5-7-13(3)6-4-8-14-12(13)9-11/h11H,1,4-9H2,2-3H3/p+1/t11-,13+/m0/s1 |
InChIKey | IUOUFRPMLZKTGM-WCQYABFASA-O |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CC(=C)[CH]1CC[C]2(C)CCC[NH+]=C2C1 | CACTVS 3.370 | CC(=C)[C@H]1CC[C@@]2(C)CCC[NH+]=C2C1 | OpenEye OEToolkits 1.7.6 | CC(=C)C1CCC2(CCC[NH+]=C2C1)C | OpenEye OEToolkits 1.7.6 | CC(=C)[C@H]1CC[C@]2(CCC[NH+]=C2C1)C | ACDLabs 12.01 | C21=[NH+]CCCC1(CCC(/C(=C)C)C2)C |
|
Formula | C13 H22 N |
Name | (4aS,7S)-4a-methyl-7-(prop-1-en-2-yl)-2,3,4,4a,5,6,7,8-octahydroquinolinium |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 4kvi Chain A Residue 705
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|