Structure of PDB 4jsg Chain A Binding Site BS03 |
|
|
Ligand ID | Q10 |
InChI | InChI=1S/C16H21N3O2/c1-12-8-13(19-16(18)9-12)11-21-15-5-2-4-14(10-15)20-7-3-6-17/h2,4-5,8-10H,3,6-7,11,17H2,1H3,(H2,18,19) |
InChIKey | USONDHXIUNXLQT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1cc(nc(c1)N)COc2cccc(c2)OCCCN | ACDLabs 12.01 | O(c2cccc(OCc1nc(N)cc(c1)C)c2)CCCN | CACTVS 3.370 | Cc1cc(N)nc(COc2cccc(OCCCN)c2)c1 |
|
Formula | C16 H21 N3 O2 |
Name | 6-{[3-(3-aminopropoxy)phenoxy]methyl}-4-methylpyridin-2-amine |
ChEMBL | CHEMBL2414429 |
DrugBank | |
ZINC | ZINC000095921106
|
PDB chain | 4jsg Chain A Residue 804
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|