Structure of PDB 4e91 Chain A Binding Site BS03 |
|
|
Ligand ID | 0OE |
InChI | InChI=1S/C29H23ClN6O2/c30-23-4-1-3-22(15-23)27-24(17-32-34-27)28-33-25-16-21(19-5-7-20(8-6-19)29(37)38)9-10-26(25)36(28)13-2-12-35-14-11-31-18-35/h1,3-11,14-18H,2,12-13H2,(H,32,34)(H,37,38) |
InChIKey | LGXPZODGTPYYBU-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | OC(=O)c1ccc(cc1)c2ccc3n(CCCn4ccnc4)c(nc3c2)c5cn[nH]c5c6cccc(Cl)c6 | ACDLabs 12.01 | O=C(O)c1ccc(cc1)c3cc2nc(n(c2cc3)CCCn4ccnc4)c6c(c5cccc(Cl)c5)nnc6 | OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)Cl)c2c(cn[nH]2)c3nc4cc(ccc4n3CCCn5ccnc5)c6ccc(cc6)C(=O)O |
|
Formula | C29 H23 Cl N6 O2 |
Name | 4-{2-[5-(3-chlorophenyl)-1H-pyrazol-4-yl]-1-[3-(1H-imidazol-1-yl)propyl]-1H-benzimidazol-5-yl}benzoic acid |
ChEMBL | CHEMBL5171005 |
DrugBank | |
ZINC |
|
PDB chain | 4e91 Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|