Structure of PDB 4e1e Chain A Binding Site BS03 |
|
|
Ligand ID | 0MW |
InChI | InChI=1S/C8H21NO6P2/c1-2-3-4-5-6-9-7-8(16(10,11)12)17(13,14)15/h8-9H,2-7H2,1H3,(H2,10,11,12)(H2,13,14,15) |
InChIKey | QDLXIUDMSHZYCG-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCCCCCNCC([P](O)(O)=O)[P](O)(O)=O | ACDLabs 12.01 | O=P(O)(O)C(CNCCCCCC)P(=O)(O)O | OpenEye OEToolkits 1.7.6 | CCCCCCNCC(P(=O)(O)O)P(=O)(O)O |
|
Formula | C8 H21 N O6 P2 |
Name | [2-(hexylamino)ethane-1,1-diyl]bis(phosphonic acid) |
ChEMBL | CHEMBL259192 |
DrugBank | |
ZINC | ZINC000029060918
|
PDB chain | 4e1e Chain A Residue 404
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|