Structure of PDB 4d3a Chain A Binding Site BS03 |
|
|
Ligand ID | 7F5 |
InChI | InChI=1S/C19H22FN5/c1-15-13-22-14-25(15)19-23-11-8-18(24-19)7-10-21-9-3-5-16-4-2-6-17(20)12-16/h2,4,6,8,11-14,21H,3,5,7,9-10H2,1H3 |
InChIKey | XNNXUOKGLOGLRV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1cncn1c2nccc(n2)CCNCCCc3cccc(c3)F | CACTVS 3.385 | Cc1cncn1c2nccc(CCNCCCc3cccc(F)c3)n2 | ACDLabs 12.01 | Fc1cccc(c1)CCCNCCc2nc(ncc2)n3c(cnc3)C |
|
Formula | C19 H22 F N5 |
Name | 3-(3-fluorophenyl)-N-{2-[2-(5-methyl-1H-imidazol-1-yl)pyrimidin-4-yl]ethyl}propan-1-amine |
ChEMBL | CHEMBL3547160 |
DrugBank | |
ZINC | ZINC000263621227
|
PDB chain | 4d3a Chain A Residue 800
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|