Structure of PDB 4cun Chain A Binding Site BS03 |
|
|
Ligand ID | WS6 |
InChI | InChI=1S/C11H13N5O2/c1-11-4-2-3-5(17)7(11)13-6-8(16-11)14-10(12)15-9(6)18/h2-4H2,1H3,(H4,12,14,15,16,18)/t11-/m0/s1 |
InChIKey | FFUUFCSJQNSUEJ-NSHDSACASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C@]12CCCC(=O)C1=NC3=C(N2)N=C(N)NC3=O | CACTVS 3.385 | C[C]12CCCC(=O)C1=NC3=C(N2)N=C(N)NC3=O | OpenEye OEToolkits 1.7.6 | CC12CCCC(=O)C1=NC3=C(N2)N=C(NC3=O)N | ACDLabs 12.01 | O=C2C=3N=C1C(=O)CCCC1(NC=3N=C(N)N2)C |
|
Formula | C11 H13 N5 O2 |
Name | (9aS)-2-amino-9a-methyl-8,9,9a,10-tetrahydrobenzo[g]pteridine-4,6(3H,7H)-dione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098209588
|
PDB chain | 4cun Chain A Residue 800
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|