Structure of PDB 4cty Chain A Binding Site BS03 |
|
|
Ligand ID | S5D |
InChI | InChI=1S/C22H27N5/c1-14-8-18(26-21(24)10-14)7-6-16-4-3-5-17(12-16)20(23)13-19-9-15(2)11-22(25)27-19/h3-5,8-12,20H,6-7,13,23H2,1-2H3,(H2,24,26)(H2,25,27)/t20-/m1/s1 |
InChIKey | HPGDXHOKQNTRIC-HXUWFJFHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1cc(N)nc(CCc2cccc(c2)[C@H](N)Cc3cc(C)cc(N)n3)c1 | CACTVS 3.385 | Cc1cc(N)nc(CCc2cccc(c2)[CH](N)Cc3cc(C)cc(N)n3)c1 | OpenEye OEToolkits 1.7.6 | Cc1cc(nc(c1)N)CCc2cccc(c2)C(Cc3cc(cc(n3)N)C)N | OpenEye OEToolkits 1.7.6 | Cc1cc(nc(c1)N)CCc2cccc(c2)[C@@H](Cc3cc(cc(n3)N)C)N | ACDLabs 12.01 | n1c(N)cc(cc1CCc2cccc(c2)C(N)Cc3nc(N)cc(c3)C)C |
|
Formula | C22 H27 N5 |
Name | (R)-6-(2-Amino-2-(3-(2-(6-amino-4-methylpyridin-2-yl)ethyl)phenyl)ethyl)-4-methylpyridin-2-amine |
ChEMBL | CHEMBL3262018 |
DrugBank | |
ZINC | ZINC000098209389
|
PDB chain | 4cty Chain A Residue 800
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|