Structure of PDB 4ctw Chain A Binding Site BS03 |
|
|
Ligand ID | S71 |
InChI | InChI=1S/C22H28N6/c1-14-5-19(27-21(24)7-14)4-3-16-9-18(13-26-12-16)17(11-23)10-20-6-15(2)8-22(25)28-20/h5-9,12-13,17H,3-4,10-11,23H2,1-2H3,(H2,24,27)(H2,25,28)/t17-/m0/s1 |
InChIKey | HKLFDCGBVFYQPQ-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1cc(N)nc(CCc2cncc(c2)[CH](CN)Cc3cc(C)cc(N)n3)c1 | OpenEye OEToolkits 1.7.6 | Cc1cc(nc(c1)N)CCc2cc(cnc2)C(Cc3cc(cc(n3)N)C)CN | CACTVS 3.385 | Cc1cc(N)nc(CCc2cncc(c2)[C@H](CN)Cc3cc(C)cc(N)n3)c1 | OpenEye OEToolkits 1.7.6 | Cc1cc(nc(c1)N)CCc2cc(cnc2)[C@@H](Cc3cc(cc(n3)N)C)CN | ACDLabs 12.01 | n1c(N)cc(cc1CCc2cc(cnc2)C(Cc3nc(N)cc(c3)C)CN)C |
|
Formula | C22 H28 N6 |
Name | (R)-6-(3-amino-2-(5-(2-(6-amino-4-methylpyridin-2-yl)ethyl)pyridin-3-yl)propyl)-4-methylpyridin-2-amine |
ChEMBL | CHEMBL3262026 |
DrugBank | |
ZINC | ZINC000098209390
|
PDB chain | 4ctw Chain A Residue 1719
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|