Structure of PDB 4ctu Chain A Binding Site BS03 |
|
|
Ligand ID | S42 |
InChI | InChI=1S/C23H29N5/c1-15-8-20(27-22(25)10-15)7-6-17-4-3-5-18(12-17)19(14-24)13-21-9-16(2)11-23(26)28-21/h3-5,8-12,19H,6-7,13-14,24H2,1-2H3,(H2,25,27)(H2,26,28)/t19-/m0/s1 |
InChIKey | ZFHITWHLDPDYFG-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1cc(N)nc(CCc2cccc(c2)[C@H](CN)Cc3cc(C)cc(N)n3)c1 | ACDLabs 12.01 | n1c(N)cc(cc1CCc2cccc(c2)C(Cc3nc(N)cc(c3)C)CN)C | CACTVS 3.385 | Cc1cc(N)nc(CCc2cccc(c2)[CH](CN)Cc3cc(C)cc(N)n3)c1 | OpenEye OEToolkits 1.7.6 | Cc1cc(nc(c1)N)CCc2cccc(c2)C(Cc3cc(cc(n3)N)C)CN | OpenEye OEToolkits 1.7.6 | Cc1cc(nc(c1)N)CCc2cccc(c2)[C@@H](Cc3cc(cc(n3)N)C)CN |
|
Formula | C23 H29 N5 |
Name | 6-[(2R)-3-amino-2-{3-[2-(6-amino-4-methylpyridin-2-yl)ethyl]phenyl}propyl]-4-methylpyridin-2-amine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098209387
|
PDB chain | 4ctu Chain A Residue 800
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|