Structure of PDB 3zns Chain A Binding Site BS03 |
|
|
Ligand ID | NU7 |
InChI | InChI=1S/C26H24F3N5O2S/c1-34-12-10-25(11-13-34,24-31-20(15-37-24)17-6-3-2-4-7-17)16-30-22(35)19-9-5-8-18(14-19)21-32-23(36-33-21)26(27,28)29/h2-9,14-15H,10-13,16H2,1H3,(H,30,35) |
InChIKey | BQFISAUAZNJOEG-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CN1CCC(CC1)(CNC(=O)c2cccc(c2)c3noc(n3)C(F)(F)F)c4scc(n4)c5ccccc5 | ACDLabs 12.01 | FC(F)(F)c1nc(no1)c2cccc(c2)C(=O)NCC5(c3nc(cs3)c4ccccc4)CCN(C)CC5 | OpenEye OEToolkits 1.7.6 | CN1CCC(CC1)(CNC(=O)c2cccc(c2)c3nc(on3)C(F)(F)F)c4nc(cs4)c5ccccc5 |
|
Formula | C26 H24 F3 N5 O2 S |
Name | N-{[1-methyl-4-(4-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]methyl}-3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
ChEMBL | CHEMBL4525406 |
DrugBank | |
ZINC | ZINC000098209245
|
PDB chain | 3zns Chain A Residue 1900
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|