Structure of PDB 3znr Chain A Binding Site BS03 |
|
|
Ligand ID | NU9 |
InChI | InChI=1S/C25H21F3N4O3S/c26-25(27,28)22-31-20(32-35-22)17-7-4-8-18(13-17)21(33)29-15-24(9-11-34-12-10-24)23-30-19(14-36-23)16-5-2-1-3-6-16/h1-8,13-14H,9-12,15H2,(H,29,33) |
InChIKey | HORXBWNTEDOVKN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | FC(F)(F)c1nc(no1)c2cccc(c2)C(=O)NCC5(c3nc(cs3)c4ccccc4)CCOCC5 | CACTVS 3.370 | FC(F)(F)c1onc(n1)c2cccc(c2)C(=O)NCC3(CCOCC3)c4scc(n4)c5ccccc5 | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)c2csc(n2)C3(CCOCC3)CNC(=O)c4cccc(c4)c5nc(on5)C(F)(F)F |
|
Formula | C25 H21 F3 N4 O3 S |
Name | N-{[4-(4-phenyl-1,3-thiazol-2-yl)tetrahydro-2H-pyran-4-yl]methyl}-3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
ChEMBL | CHEMBL3110004 |
DrugBank | |
ZINC | ZINC000095828732
|
PDB chain | 3znr Chain A Residue 1000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|