Structure of PDB 3uwm Chain A Binding Site BS03 |
|
|
Ligand ID | 0JX |
InChI | InChI=1S/C4H10O8P2/c5-3-1-2-4-11-14(9,10)12-13(6,7)8/h1,3,5H,2,4H2,(H,9,10)(H2,6,7,8)/b3-1+ |
InChIKey | YCGPFMCUJHDYHD-HNQUOIGGSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C(COP(=O)(O)OP(=O)(O)O)/C=C/O | ACDLabs 12.01 | O=P(O)(O)OP(=O)(OCC\C=C\O)O | OpenEye OEToolkits 1.7.6 | C(COP(=O)(O)OP(=O)(O)O)C=CO | CACTVS 3.370 | OC=CCCO[P](O)(=O)O[P](O)(O)=O | CACTVS 3.370 | O\C=C\CCO[P](O)(=O)O[P](O)(O)=O |
|
Formula | C4 H10 O8 P2 |
Name | (3E)-4-hydroxybut-3-en-1-yl trihydrogen diphosphate |
ChEMBL | CHEMBL145026 |
DrugBank | |
ZINC | ZINC000100927824
|
PDB chain | 3uwm Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.17.7.4: 4-hydroxy-3-methylbut-2-enyl diphosphate reductase. |
|
|
|