Structure of PDB 3ufv Chain A Binding Site BS03 |
|
|
Ligand ID | HW9 |
InChI | InChI=1S/C22H32N4O/c1-16-7-8-25-19(10-16)6-4-3-5-9-27-21-15-24-14-18(21)13-20-11-17(2)12-22(23)26-20/h7-8,10-12,18,21,24H,3-6,9,13-15H2,1-2H3,(H2,23,26)/t18-,21+/m1/s1 |
InChIKey | ZWYPXJQSZOXLSP-NQIIRXRSSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O(CCCCCc1nccc(c1)C)C2C(CNC2)Cc3nc(N)cc(c3)C | OpenEye OEToolkits 1.7.6 | Cc1ccnc(c1)CCCCCOC2CNCC2Cc3cc(cc(n3)N)C | CACTVS 3.370 | Cc1ccnc(CCCCCO[C@H]2CNC[C@H]2Cc3cc(C)cc(N)n3)c1 | OpenEye OEToolkits 1.7.6 | Cc1ccnc(c1)CCCCCO[C@H]2CNC[C@H]2Cc3cc(cc(n3)N)C | CACTVS 3.370 | Cc1ccnc(CCCCCO[CH]2CNC[CH]2Cc3cc(C)cc(N)n3)c1 |
|
Formula | C22 H32 N4 O |
Name | 4-methyl-6-{[(3R,4R)-4-{[5-(4-methylpyridin-2-yl)pentyl]oxy}pyrrolidin-3-yl]methyl}pyridin-2-amine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921163
|
PDB chain | 3ufv Chain A Residue 800
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|