Structure of PDB 3tym Chain A Binding Site BS03 |
|
|
Ligand ID | 08R |
InChI | InChI=1S/C21H30N4O2/c1-15-9-18(25-21(22)10-15)11-17-13-24-14-20(17)27-8-7-23-12-16-5-3-4-6-19(16)26-2/h3-6,9-10,17,20,23-24H,7-8,11-14H2,1-2H3,(H2,22,25)/t17-,20+/m0/s1 |
InChIKey | CNZPKQOAIMARQF-FXAWDEMLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | Cc1cc(nc(c1)N)C[C@H]2CNC[C@H]2OCCNCc3ccccc3OC | ACDLabs 12.01 | O(CCNCc1ccccc1OC)C2C(CNC2)Cc3nc(N)cc(c3)C | OpenEye OEToolkits 1.7.2 | Cc1cc(nc(c1)N)CC2CNCC2OCCNCc3ccccc3OC | CACTVS 3.370 | COc1ccccc1CNCCO[CH]2CNC[CH]2Cc3cc(C)cc(N)n3 | CACTVS 3.370 | COc1ccccc1CNCCO[C@@H]2CNC[C@@H]2Cc3cc(C)cc(N)n3 |
|
Formula | C21 H30 N4 O2 |
Name | 6-{[(3S,4S)-4-{2-[(2-methoxybenzyl)amino]ethoxy}pyrrolidin-3-yl]methyl}-4-methylpyridin-2-amine |
ChEMBL | CHEMBL1956739 |
DrugBank | |
ZINC | ZINC000073309992
|
PDB chain | 3tym Chain A Residue 800
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|