Structure of PDB 3qvt Chain A Binding Site BS03 |
|
|
Ligand ID | KPG |
InChI | InChI=1S/C6H13O10P/c7-2(1-16-17(13,14)15)3(8)4(9)5(10)6(11)12/h3-6,8-12H,1H2,(H2,13,14,15)/t3-,4+,5+/m1/s1 |
InChIKey | GGBBRMAUDBKNLU-WISUUJSJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | C(C(=O)[C@H]([C@@H]([C@@H](C(O)O)O)O)O)OP(=O)(O)O | OpenEye OEToolkits 1.7.0 | C(C(=O)C(C(C(C(O)O)O)O)O)OP(=O)(O)O | CACTVS 3.370 | OC(O)[CH](O)[CH](O)[CH](O)C(=O)CO[P](O)(O)=O | CACTVS 3.370 | OC(O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)CO[P](O)(O)=O |
|
Formula | C6 H13 O10 P |
Name | [(3S,4R,5S)-3,4,5,6,6-pentahydroxy-2-oxo-hexyl] dihydrogen phosphate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098209084
|
PDB chain | 3qvt Chain A Residue 520
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|