Structure of PDB 3ox3 Chain A Binding Site BS03 |
|
|
Ligand ID | 4X4 |
InChI | InChI=1S/C21H18N4O3/c1-27-17-7-6-15-19(24-17)14(8-10-23-21(26)16-5-3-11-28-16)20-18-13(12-25(15)20)4-2-9-22-18/h2-7,9,11-12,24H,8,10H2,1H3,(H,23,26) |
InChIKey | WIMLBKFZRMRSHL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(NCCC4=C1C(=CC=C(OC)N1)n3cc2cccnc2c34)c5occc5 | CACTVS 3.370 | COC1=CC=C2n3cc4cccnc4c3C(=C2N1)CCNC(=O)c5occc5 | OpenEye OEToolkits 1.7.0 | COc1ccc2c([nH]1)c(c3n2cc4c3nccc4)CCNC(=O)c5ccco5 |
|
Formula | C21 H18 N4 O3 |
Name | N-[2-(2-methoxy-1H-dipyrido[2,3-a:3',2'-e]pyrrolizin-11-yl)ethyl]furan-2-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000066166061
|
PDB chain | 3ox3 Chain A Residue 233
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
G149 Y155 N161 |
Catalytic site (residue number reindexed from 1) |
G148 Y154 N160 |
Enzyme Commision number |
1.10.5.1: ribosyldihydronicotinamide dehydrogenase (quinone). |
|
|
|