Structure of PDB 3okh Chain A Binding Site BS03 |
|
|
Ligand ID | OKH |
InChI | InChI=1S/C28H32ClN3O3/c29-21-14-11-19(12-15-21)26-31-23-16-13-20(28(34)35)17-24(23)32(26)25(18-7-3-1-4-8-18)27(33)30-22-9-5-2-6-10-22/h11-18,22,25H,1-10H2,(H,30,33)(H,34,35)/t25-/m0/s1 |
InChIKey | BGTNSFBYQMPTOK-VWLOTQADSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1cc(ccc1c2nc3ccc(cc3n2[C@@H](C4CCCCC4)C(=O)NC5CCCCC5)C(=O)O)Cl | CACTVS 3.370 | OC(=O)c1ccc2nc(n([C@@H](C3CCCCC3)C(=O)NC4CCCCC4)c2c1)c5ccc(Cl)cc5 | ACDLabs 12.01 | O=C(O)c2ccc3nc(c1ccc(Cl)cc1)n(c3c2)C(C(=O)NC4CCCCC4)C5CCCCC5 | CACTVS 3.370 | OC(=O)c1ccc2nc(n([CH](C3CCCCC3)C(=O)NC4CCCCC4)c2c1)c5ccc(Cl)cc5 | OpenEye OEToolkits 1.7.0 | c1cc(ccc1c2nc3ccc(cc3n2C(C4CCCCC4)C(=O)NC5CCCCC5)C(=O)O)Cl |
|
Formula | C28 H32 Cl N3 O3 |
Name | 2-(4-chlorophenyl)-1-[(1S)-1-cyclohexyl-2-(cyclohexylamino)-2-oxoethyl]-1H-benzimidazole-6-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058661266
|
PDB chain | 3okh Chain A Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|