Structure of PDB 3nlz Chain A Binding Site BS03 |
|
|
Ligand ID | 3XD |
InChI | InChI=1S/C21H28F2N4O/c1-15-9-18(27-20(24)10-15)11-16-12-26-13-19(16)28-8-7-25-14-21(22,23)17-5-3-2-4-6-17/h2-6,9-10,16,19,25-26H,7-8,11-14H2,1H3,(H2,24,27)/t16-,19+/m1/s1 |
InChIKey | RTMROEXMNLIGEG-APWZRJJASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | Cc1cc(nc(c1)N)CC2CNCC2OCCNCC(c3ccccc3)(F)F | CACTVS 3.370 | Cc1cc(N)nc(C[CH]2CNC[CH]2OCCNCC(F)(F)c3ccccc3)c1 | OpenEye OEToolkits 1.7.0 | Cc1cc(nc(c1)N)C[C@@H]2CNC[C@@H]2OCCNCC(c3ccccc3)(F)F | ACDLabs 12.01 | FC(F)(c1ccccc1)CNCCOC2C(CNC2)Cc3nc(N)cc(c3)C | CACTVS 3.370 | Cc1cc(N)nc(C[C@@H]2CNC[C@@H]2OCCNCC(F)(F)c3ccccc3)c1 |
|
Formula | C21 H28 F2 N4 O |
Name | 6-{[(3R,4R)-4-{2-[(2,2-difluoro-2-phenylethyl)amino]ethoxy}pyrrolidin-3-yl]methyl}-4-methylpyridin-2-amine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000064746418
|
PDB chain | 3nlz Chain A Residue 800
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|