Structure of PDB 3mtw Chain A Binding Site BS03 |
|
|
Ligand ID | M3R |
InChI | InChI=1S/C7H17N4O4P/c1-16(14,15)11-5(6(12)13)3-2-4-10-7(8)9/h5H,2-4H2,1H3,(H,12,13)(H4,8,9,10)(H2,11,14,15)/t5-/m0/s1 |
InChIKey | BJBJPERGZRNAQZ-YFKPBYRVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | [H]N=C(N)NCCCC(C(=O)O)NP(=O)(C)O | CACTVS 3.341 | C[P@](O)(=O)N[C@@H](CCCNC(N)=N)C(O)=O | CACTVS 3.341 | C[P](O)(=O)N[CH](CCCNC(N)=N)C(O)=O | ACDLabs 10.04 | O=P(O)(NC(C(=O)O)CCCNC(=[N@H])N)C | OpenEye OEToolkits 1.5.0 | [H]/N=C(\N)/NCCC[C@@H](C(=O)O)N[P@@](=O)(C)O |
|
Formula | C7 H17 N4 O4 P |
Name | Methyl phosphonated L-Arginine; (2S)-5-carbamimidamido-2-[(hydroxy-methyl-phosphoryl)amino]pentanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058639145
|
PDB chain | 3mtw Chain A Residue 430
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|