Structure of PDB 3h63 Chain A Binding Site BS03 |
|
|
Ligand ID | NHC |
InChI | InChI=1S/C10H14O5/c1-9(7(11)12)5-3-4-6(15-5)10(9,2)8(13)14/h5-6H,3-4H2,1-2H3,(H,11,12)(H,13,14)/t5-,6+,9+,10- |
InChIKey | NMTNUQBORQILRK-XCVPVQRUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC1(C2CCC(C1(C)C(=O)O)O2)C(=O)O | ACDLabs 10.04 | O=C(O)C1(C(C(=O)O)(C)C2OC1CC2)C | OpenEye OEToolkits 1.5.0 | C[C@]1([C@H]2CC[C@@H]([C@]1(C)C(=O)O)O2)C(=O)O | CACTVS 3.341 | C[C]1([CH]2CC[CH](O2)[C]1(C)C(O)=O)C(O)=O | CACTVS 3.341 | C[C@]1([C@H]2CC[C@H](O2)[C@]1(C)C(O)=O)C(O)=O |
|
Formula | C10 H14 O5 |
Name | (1R,2S,3R,4S)-2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid; Cantharidic acid |
ChEMBL | CHEMBL1234720 |
DrugBank | |
ZINC | ZINC000013783286
|
PDB chain | 3h63 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|