Structure of PDB 3eqb Chain A Binding Site BS03 |
|
|
Ligand ID | LUG |
InChI | InChI=1S/C16H13F3IN5O/c17-10-3-2-9(15-24-25-16(26-15)22-6-5-21)14(13(10)19)23-12-4-1-8(20)7-11(12)18/h1-4,7,23H,5-6,21H2,(H,22,25) |
InChIKey | FPDWDLAITHFTTP-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | Ic1ccc(c(F)c1)Nc3c(F)c(F)ccc3c2nnc(o2)NCCN | OpenEye OEToolkits 1.5.0 | c1cc(c(cc1I)F)Nc2c(ccc(c2F)F)c3nnc(o3)NCCN | CACTVS 3.341 | NCCNc1oc(nn1)c2ccc(F)c(F)c2Nc3ccc(I)cc3F |
|
Formula | C16 H13 F3 I N5 O |
Name | N-(5-{3,4-difluoro-2-[(2-fluoro-4-iodophenyl)amino]phenyl}-1,3,4-oxadiazol-2-yl)ethane-1,2-diamine |
ChEMBL | CHEMBL485945 |
DrugBank | DB08130 |
ZINC | ZINC000034285190
|
PDB chain | 3eqb Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|