Structure of PDB 3cqw Chain A Binding Site BS03 |
|
|
Ligand ID | CQW |
InChI | InChI=1S/C12H11ClN6/c13-7-3-14-11-10(7)12(18-6-17-11)19-2-1-8-9(4-19)16-5-15-8/h3,5-6H,1-2,4H2,(H,15,16)(H,14,17,18) |
InChIKey | YFFJXGRXFASBDL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1c(c2c([nH]1)ncnc2N3CCc4c(nc[nH]4)C3)Cl | OpenEye OEToolkits 1.5.0 | c1c(c2c([nH]1)ncnc2[N@]3CCc4c(nc[nH]4)C3)Cl | ACDLabs 10.04 | Clc4c1c(ncnc1N3Cc2ncnc2CC3)nc4 | CACTVS 3.341 | Clc1c[nH]c2ncnc(N3CCc4[nH]cnc4C3)c12 |
|
Formula | C12 H11 Cl N6 |
Name | 5-(5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine |
ChEMBL | CHEMBL259833 |
DrugBank | DB07585 |
ZINC | ZINC000016052800
|
PDB chain | 3cqw Chain A Residue 999
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|