Structure of PDB 2bwm Chain A Binding Site BS03 |
|
|
Ligand ID | SNG |
InChI | InChI=1S/C9H17NO5Se/c1-4(12)10-6-8(14)7(13)5(3-11)15-9(6)16-2/h5-9,11,13-14H,3H2,1-2H3,(H,10,12)/t5-,6-,7-,8-,9+/m1/s1 |
InChIKey | AZZZNYGPGINRNT-OKNNCHMLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1[Se]C)CO)O)O | CACTVS 3.341 | C[Se][CH]1O[CH](CO)[CH](O)[CH](O)[CH]1NC(C)=O | CACTVS 3.341 | C[Se][C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(C)=O | OpenEye OEToolkits 1.5.0 | CC(=O)NC1C(C(C(OC1[Se]C)CO)O)O | ACDLabs 10.04 | O=C(NC1C(O)C(O)C(OC1[Se]C)CO)C |
|
Formula | C9 H17 N O5 Se |
Name | methyl 2-acetamido-2-deoxy-1-seleno-beta-D-glucopyranoside; METHYL 2-ACETAMIDO-1,2-DIDEOXY-1-SELENO-BETA-D-GLUCOPYRANOSIDE; methyl 2-acetamido-2-deoxy-1-seleno-beta-D-glucoside; methyl 2-acetamido-2-deoxy-1-seleno-D-glucoside; methyl 2-acetamido-2-deoxy-1-seleno-glucoside |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 2bwm Chain A Residue 1403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|