Structure of PDB 1fmj Chain A Binding Site BS03 |
|
|
Ligand ID | RTL |
InChI | InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3/b9-6+,12-11+,16-8+,17-13+ |
InChIKey | FPIPGXGPPPQFEQ-OVSJKPMPSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(=CCO)C=CC=C(C)C=CC1=C(C)CCCC1(C)C | ACDLabs 12.01 | C1(CCCC(=C1\C=C\C(=C\C=C\C(=C\CO)C)C)C)(C)C | OpenEye OEToolkits 2.0.7 | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/CO)/C)/C | OpenEye OEToolkits 2.0.7 | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CCO)C)C | CACTVS 3.385 | CC(=C\CO)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
|
Formula | C20 H30 O |
Name | RETINOL |
ChEMBL | CHEMBL986 |
DrugBank | DB00162 |
ZINC | ZINC000003831417
|
PDB chain | 1fmj Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
R73 H164 S193 |
Catalytic site (residue number reindexed from 1) |
R66 H157 S186 |
Enzyme Commision number |
? |
|
|
|