Structure of PDB 5isq Chain X Binding Site BS02 |
|
|
Ligand ID | U06 |
InChI | InChI=1S/C23H22N4O3/c1-3-19-18(21(24)27-23(25)26-19)6-4-5-17-13-16(11-12-20(17)30-2)14-7-9-15(10-8-14)22(28)29/h7-13H,3,5H2,1-2H3,(H,28,29)(H4,24,25,26,27) |
InChIKey | KQGRJTMRAQWNLV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | CCc1c(c(nc(n1)N)N)C#CCc2cc(ccc2OC)c3ccc(cc3)C(=O)O | CACTVS 3.385 | CCc1nc(N)nc(N)c1C#CCc2cc(ccc2OC)c3ccc(cc3)C(O)=O |
|
Formula | C23 H22 N4 O3 |
Name | 4-[3-[3-[2,4-bis(azanyl)-6-ethyl-pyrimidin-5-yl]prop-2-ynyl]-4-methoxy-phenyl]benzoic acid; 3'-(3-(2,4-diamino-6-ethylpyrimidin-5-yl)prop-2-yn-1-yl)-4'-methoxy-[1,1'-biphenyl]-4-carboxylic acid; UCP1106 |
ChEMBL | CHEMBL3827532 |
DrugBank | |
ZINC | ZINC000584905708
|
PDB chain | 5isq Chain X Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
L5 |
Catalytic site (residue number reindexed from 1) |
L5 |
Enzyme Commision number |
1.5.1.3: dihydrofolate reductase. |
|
|
|