Structure of PDB 3sru Chain X Binding Site BS02 |
|
|
Ligand ID | Q26 |
InChI | InChI=1S/C23H23N5O3S/c1-3-31-21-10-8-15(14-5-4-6-17(11-14)28-32(2,29)30)12-19(21)16-7-9-18-20(13-16)26-23(25)27-22(18)24/h4-13,28H,3H2,1-2H3,(H4,24,25,26,27) |
InChIKey | KBZJKRXRDPRBNM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCOc1ccc(cc1c2ccc3c(N)nc(N)nc3c2)c4cccc(N[S](C)(=O)=O)c4 | ACDLabs 12.01 | O=S(=O)(Nc1cccc(c1)c4cc(c3ccc2c(nc(nc2N)N)c3)c(OCC)cc4)C | OpenEye OEToolkits 1.7.2 | CCOc1ccc(cc1c2ccc3c(c2)nc(nc3N)N)c4cccc(c4)NS(=O)(=O)C |
|
Formula | C23 H23 N5 O3 S |
Name | N-[3'-(2,4-diaminoquinazolin-7-yl)-4'-ethoxybiphenyl-3-yl]methanesulfonamide |
ChEMBL | CHEMBL1818127 |
DrugBank | |
ZINC | ZINC000072116526
|
PDB chain | 3sru Chain X Residue 169
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
L6 |
Catalytic site (residue number reindexed from 1) |
L5 |
Enzyme Commision number |
1.5.1.3: dihydrofolate reductase. |
|
|
|