Structure of PDB 3nz9 Chain X Binding Site BS02 |
|
|
Ligand ID | D2K |
InChI | InChI=1S/C22H27N5O4/c1-4-30-18(28)6-5-9-31-16-7-8-17(29-3)14(11-16)10-15-12-25-21-19(13(15)2)20(23)26-22(24)27-21/h7-8,11-12H,4-6,9-10H2,1-3H3,(H4,23,24,25,26,27) |
InChIKey | OJXNTDHQQMJPKJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CCOC(=O)CCCOc1ccc(c(c1)Cc2cnc3c(c2C)c(nc(n3)N)N)OC | ACDLabs 12.01 | O=C(OCC)CCCOc1cc(c(OC)cc1)Cc2c(c3c(nc2)nc(nc3N)N)C | CACTVS 3.370 | CCOC(=O)CCCOc1ccc(OC)c(Cc2cnc3nc(N)nc(N)c3c2C)c1 |
|
Formula | C22 H27 N5 O4 |
Name | ethyl 4-{3-[(2,4-diamino-5-methylpyrido[2,3-d]pyrimidin-6-yl)methyl]-4-methoxyphenoxy}butanoate |
ChEMBL | CHEMBL189796 |
DrugBank | |
ZINC | ZINC000013646394
|
PDB chain | 3nz9 Chain X Residue 207
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.5.1.3: dihydrofolate reductase. |
|
|
|