Structure of PDB 3fra Chain X Binding Site BS02 |
|
|
Ligand ID | I2H |
InChI | InChI=1S/C19H22N4O3/c1-24-15-8-11(7-12-9-22-19(21)23-18(12)20)13-5-6-14(10-3-4-10)26-16(13)17(15)25-2/h5-6,8-10,14H,3-4,7H2,1-2H3,(H4,20,21,22,23)/t14-/m1/s1 |
InChIKey | HWJPWWYTGBZDEG-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cc(Cc2cnc(N)nc2N)c3C=C[CH](Oc3c1OC)C4CC4 | ACDLabs 12.01 | n1cc(c(nc1N)N)Cc3cc(OC)c(OC)c2OC(C=Cc23)C4CC4 | OpenEye OEToolkits 1.7.6 | COc1cc(c2c(c1OC)OC(C=C2)C3CC3)Cc4cnc(nc4N)N | OpenEye OEToolkits 1.7.6 | COc1cc(c2c(c1OC)O[C@H](C=C2)C3CC3)Cc4cnc(nc4N)N | CACTVS 3.385 | COc1cc(Cc2cnc(N)nc2N)c3C=C[C@@H](Oc3c1OC)C4CC4 |
|
Formula | C19 H22 N4 O3 |
Name | 5-{[(2S)-2-cyclopropyl-7,8-dimethoxy-2H-chromen-5-yl]methyl}pyrimidine-2,4-diamine |
ChEMBL | CHEMBL1673303 |
DrugBank | DB07938 |
ZINC | ZINC000001486728
|
PDB chain | 3fra Chain X Residue 300
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
L5 |
Catalytic site (residue number reindexed from 1) |
L5 |
Enzyme Commision number |
1.5.1.3: dihydrofolate reductase. |
|
|
|