Structure of PDB 6u9d Chain R Binding Site BS02 |
|
|
Ligand ID | 60G |
InChI | InChI=1S/C16H18N4O7S/c1-25-12-8-13(26-2)18-15(17-12)19-16(22)20-28(23,24)9-10-6-4-5-7-11(10)14(21)27-3/h4-8H,9H2,1-3H3,(H2,17,18,19,20,22) |
InChIKey | XMQFTWRPUQYINF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | COc1cc(nc(n1)NC(=O)NS(=O)(=O)Cc2ccccc2C(=O)OC)OC | CACTVS 3.385 | COC(=O)c1ccccc1C[S](=O)(=O)NC(=O)Nc2nc(OC)cc(OC)n2 |
|
Formula | C16 H18 N4 O7 S |
Name | methyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoylmethyl]benzoate; Bensulfuron methyl |
ChEMBL | CHEMBL2313154 |
DrugBank | |
ZINC | ZINC000001532062
|
PDB chain | 6u9d Chain Q Residue 704
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|