Structure of PDB 6e2b Chain P Binding Site BS02 |
|
|
Ligand ID | PT7 |
InChI | InChI=1S/C18H15P.C11H8N.ClH.Pt/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-6-10(7-3-1)11-8-4-5-9-12-11;;/h1-15H;1-6,8-9H;1H;/q;;;+2 |
InChIKey | KHJLZDWNJSEPIZ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1ccc(cc1)[P](c2ccccc2)(c3ccccc3)[Pt+2]4(c5ccccc5C6=CC=CC=[N]64)Cl | CACTVS 3.385 | Cl[Pt++]c1ccccc1c2ccccn2.c3ccc(cc3)P(c4ccccc4)c5ccccc5 | ACDLabs 12.01 | [Pt+2]2(n1ccccc1c3ccccc23)(Cl)P(c4ccccc4)(c5ccccc5)c6ccccc6 |
|
Formula | C29 H23 Cl N P Pt |
Name | chloro[2-(pyridin-2-yl-kappaN)phenyl-kappaC~1~](triphenyl-lambda~5~-phosphanyl)platinum(2+); PtII(2-phenylpyridine)(tri-phenylphosphine)Cl |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6e2b Chain P Residue 104
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|