Structure of PDB 8erb Chain M Binding Site BS02 |
|
|
Ligand ID | WBJ |
InChI | InChI=1S/C12H15N2O7P/c1-3-10(12(16)17)14-5-9-8(6-21-22(18,19)20)4-13-7(2)11(9)15/h3-4,15H,1,5-6H2,2H3,(H,16,17)(H2,18,19,20)/b14-10+ |
InChIKey | ILCWREDNKMRIGC-GXDHUFHOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | Cc1c(c(c(cn1)COP(=O)(O)O)CN=C(C=C)C(=O)O)O | OpenEye OEToolkits 2.0.7 | Cc1c(c(c(cn1)COP(=O)(O)O)C/N=C(\C=C)/C(=O)O)O | CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c(CN=C(C=C)C(O)=O)c1O | ACDLabs 12.01 | Cc1c(c(C/N=C(/C(O)=O)\C=C)c(COP(O)(O)=O)cn1)O |
|
Formula | C12 H15 N2 O7 P |
Name | (2E)-2-[({3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methyl)imino]but-3-enoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8erb Chain E Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|