Structure of PDB 4h19 Chain L Binding Site BS02 |
|
|
Ligand ID | 0YR |
InChI | InChI=1S/C5H11NO6/c7-1-2(8)3(9)4(10)5(11)6-12/h2-4,7-10,12H,1H2,(H,6,11)/t2-,3-,4-/m1/s1 |
InChIKey | AGVYHANDLPZRFS-BXXZVTAOSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(NO)C(O)C(O)C(O)CO | OpenEye OEToolkits 1.7.6 | C(C(C(C(C(=O)NO)O)O)O)O | OpenEye OEToolkits 1.7.6 | C([C@H]([C@H]([C@H](C(=O)NO)O)O)O)O | CACTVS 3.370 | OC[CH](O)[CH](O)[CH](O)C(=O)NO | CACTVS 3.370 | OC[C@@H](O)[C@@H](O)[C@@H](O)C(=O)NO |
|
Formula | C5 H11 N O6 |
Name | (2R,3R,4R)-N,2,3,4,5-pentakis(oxidanyl)pentanamide; D-ribonohydroxamate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 4h19 Chain L Residue 407
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|