Structure of PDB 7x01 Chain J Binding Site BS02 |
|
|
Ligand ID | 7XQ |
InChI | InChI=1S/C12H16FN5O3/c13-6-5(1-2-19)9(20)10(21)8(6)18-4-17-7-11(14)15-3-16-12(7)18/h3-6,8-10,19-21H,1-2H2,(H2,14,15,16)/t5-,6+,8+,9+,10-/m0/s1 |
InChIKey | BHBYBYPYUGVDDF-LUTUWXHWSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1nc(c2c(n1)n(cn2)C3C(C(C(C3F)CCO)O)O)N | OpenEye OEToolkits 2.0.7 | c1nc(c2c(n1)n(cn2)[C@H]3[C@@H]([C@@H]([C@H]([C@H]3F)CCO)O)O)N | CACTVS 3.385 | Nc1ncnc2n(cnc12)[C@H]3[C@H](O)[C@H](O)[C@@H](CCO)[C@H]3F | CACTVS 3.385 | Nc1ncnc2n(cnc12)[CH]3[CH](O)[CH](O)[CH](CCO)[CH]3F |
|
Formula | C12 H16 F N5 O3 |
Name | (1R,2S,3S,4R,5R)-3-(6-aminopurin-9-yl)-4-fluoranyl-5-(2-hydroxyethyl)cyclopentane-1,2-diol |
ChEMBL | CHEMBL4638533 |
DrugBank | |
ZINC |
|
PDB chain | 7x01 Chain J Residue 1002
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|