Structure of PDB 3a2c Chain I Binding Site BS02 |
|
|
Ligand ID | PDY |
InChI | InChI=1S/C20H26N6O/c1-3-27-17-8-6-15(7-9-17)24-20-14(2)19(23-16-5-4-11-21-13-16)25-18-10-12-22-26(18)20/h6-10,12,16,21,24H,3-5,11,13H2,1-2H3,(H,23,25)/t16-/m0/s1 |
InChIKey | WJOUGMPFYANZMI-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CCOc1ccc(cc1)Nc2c(c(nc3n2ncc3)N[C@H]4CCCNC4)C | OpenEye OEToolkits 1.5.0 | CCOc1ccc(cc1)Nc2c(c(nc3n2ncc3)NC4CCCNC4)C | CACTVS 3.341 | CCOc1ccc(Nc2n3nccc3nc(N[C@H]4CCCNC4)c2C)cc1 | ACDLabs 10.04 | n3c(NC1CCCNC1)c(c(Nc2ccc(OCC)cc2)n4nccc34)C | CACTVS 3.341 | CCOc1ccc(Nc2n3nccc3nc(N[CH]4CCCNC4)c2C)cc1 |
|
Formula | C20 H26 N6 O |
Name | N~7~-(4-ethoxyphenyl)-6-methyl-N~5~-[(3S)-piperidin-3-yl]pyrazolo[1,5-a]pyrimidine-5,7-diamine; {5-[((3S)(3-piperidyl))amino]-6-methyl(pyrazolo[1,5-a]pyrimidin-7-yl)}(4-ethoxyphenyl)amine |
ChEMBL | CHEMBL1235213 |
DrugBank | |
ZINC | ZINC000058633578
|
PDB chain | 3a2c Chain I Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|