Structure of PDB 5eu9 Chain H Binding Site BS02 |
|
|
Ligand ID | 5TX |
InChI | InChI=1S/C5H10NO6P/c1-5(13(10,11)12)2-3(7)6(9)4(5)8/h3,7,9H,2H2,1H3,(H2,10,11,12)/t3-,5-/m0/s1 |
InChIKey | VVBLYPMICKYZTP-UCORVYFPSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | C[C@@]1(C[C@@H](N(C1=O)O)O)P(=O)(O)O | CACTVS 3.385 | C[C@@]1(C[C@H](O)N(O)C1=O)[P](O)(O)=O | OpenEye OEToolkits 2.0.4 | CC1(CC(N(C1=O)O)O)P(=O)(O)O | CACTVS 3.385 | C[C]1(C[CH](O)N(O)C1=O)[P](O)(O)=O |
|
Formula | C5 H10 N O6 P |
Name | ((3S,5S)-1,5-dihydroxy-3-methyl-2-oxopyrrolidin-3-yl)phosphonic acid |
ChEMBL | CHEMBL5187779 |
DrugBank | |
ZINC | ZINC000584905322
|
PDB chain | 5eu9 Chain H Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|