Structure of PDB 4zjt Chain H Binding Site BS02 |
|
|
Ligand ID | 4P6 |
InChI | InChI=1S/C15H14N2S/c1-5-13(11-16-7-1)15-12(4-2-8-17-15)10-14-6-3-9-18-14/h1,3,5-7,9-11H,2,4,8H2/b12-10+ |
InChIKey | MYYXDAYQWWIEQW-ZRDIBKRKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | c1cc(cnc1)C\2=NCCC/C2=C\c3cccs3 | CACTVS 3.385 | C1CN=C(C(C1)=Cc2sccc2)c3cccnc3 | CACTVS 3.385 | C1CN=C(\C(C1)=C\c2sccc2)c3cccnc3 | ACDLabs 12.01 | c1cncc(c1)C=2/C(CCCN=2)=C/c3cccs3 | OpenEye OEToolkits 1.9.2 | c1cc(cnc1)C2=NCCCC2=Cc3cccs3 |
|
Formula | C15 H14 N2 S |
Name | (3E)-3-(thiophen-2-ylmethylidene)-3,4,5,6-tetrahydro-2,3'-bipyridine; 2-thiophenylmethylene anabaseine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000034646060
|
PDB chain | 4zjt Chain H Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
Molecular Function |
GO:0004888 |
transmembrane signaling receptor activity |
GO:0005216 |
monoatomic ion channel activity |
GO:0005230 |
extracellular ligand-gated monoatomic ion channel activity |
GO:0005231 |
excitatory extracellular ligand-gated monoatomic ion channel activity |
GO:1904315 |
transmitter-gated monoatomic ion channel activity involved in regulation of postsynaptic membrane potential |
|
|