Structure of PDB 3tu7 Chain H Binding Site BS02 |
|
|
Ligand ID | 0BM |
InChI | InChI=1S/C22H34N6O4S/c1-33(31,32)26-18(14-16-6-3-2-4-7-16)21(30)28-11-5-8-19(28)20(29)25-15-17-9-12-27(13-10-17)22(23)24/h2-4,6-7,17-19,26H,5,8-15H2,1H3,(H3,23,24)(H,25,29)/t18-,19+/m1/s1 |
InChIKey | UCVAQBJLJIKTFJ-MOPGFXCFSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | C[S](=O)(=O)N[C@H](Cc1ccccc1)C(=O)N2CCC[C@H]2C(=O)NCC3CCN(CC3)C(N)=N | CACTVS 3.370 | C[S](=O)(=O)N[CH](Cc1ccccc1)C(=O)N2CCC[CH]2C(=O)NCC3CCN(CC3)C(N)=N | OpenEye OEToolkits 1.7.2 | CS(=O)(=O)NC(Cc1ccccc1)C(=O)N2CCCC2C(=O)NCC3CCN(CC3)C(=N)N | ACDLabs 12.01 | O=C(NCC1CCN(C(=[N@H])N)CC1)C3N(C(=O)C(NS(=O)(=O)C)Cc2ccccc2)CCC3 | OpenEye OEToolkits 1.7.2 | [H]/N=C(\N)/N1CCC(CC1)CNC(=O)[C@@H]2CCCN2C(=O)[C@@H](Cc3ccccc3)NS(=O)(=O)C |
|
Formula | C22 H34 N6 O4 S |
Name | N-(methylsulfonyl)-D-phenylalanyl-N-[(1-carbamimidoylpiperidin-4-yl)methyl]-L-prolinamide |
ChEMBL | CHEMBL356065 |
DrugBank | |
ZINC | ZINC000003807291
|
PDB chain | 3tu7 Chain H Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.21.5: thrombin. |
|
|
|