Structure of PDB 1mfb Chain H Binding Site BS02 |
|
|
Ligand ID | ABE |
InChI | InChI=1S/C6H12O4/c1-3-4(7)2-5(8)6(9)10-3/h3-9H,2H2,1H3/t3-,4-,5-,6+/m1/s1 |
InChIKey | KYPWIZMAJMNPMJ-KAZBKCHUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC1C(CC(C(O1)O)O)O | OpenEye OEToolkits 1.5.0 | C[C@@H]1[C@@H](C[C@H]([C@H](O1)O)O)O | CACTVS 3.341 | C[CH]1O[CH](O)[CH](O)C[CH]1O | ACDLabs 10.04 | OC1C(OC(O)C(O)C1)C | CACTVS 3.341 | C[C@H]1O[C@H](O)[C@H](O)C[C@H]1O |
|
Formula | C6 H12 O4 |
Name | alpha-D-Abequopyranose; alpha-D-Abequose; 3,6-dideoxy-alpha-D-xylo-hexopyranose; 3,6-dideoxy-alpha-D-gulopyranose; 3,6-dideoxy-alpha-D-galactopyranose; 3-deoxy-alpha-D-fucopyranose; D-Abequose; Abequose |
ChEMBL | |
DrugBank | DB02590 |
ZINC |
|
PDB chain | 1mfb Chain A Residue 7
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|