Structure of PDB 6t9r Chain GGG Binding Site BS02 |
|
|
Ligand ID | MXQ |
InChI | InChI=1S/C14H20N2O2/c17-5-1-2-11-3-4-13-12-6-10(7-15-8-12)9-16(13)14(11)18/h3-4,10,12,15,17H,1-2,5-9H2/t10-,12+/m0/s1 |
InChIKey | JXEXVCIRYVIYEW-CMPLNLGQSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | C1C2CNCC1C3=CC=C(C(=O)N3C2)CCCO | OpenEye OEToolkits 2.0.7 | C1[C@H]2CNC[C@@H]1C3=CC=C(C(=O)N3C2)CCCO | CACTVS 3.385 | OCCCC1=CC=C2[CH]3CNC[CH](C3)CN2C1=O | CACTVS 3.385 | OCCCC1=CC=C2[C@H]3CNC[C@H](C3)CN2C1=O |
|
Formula | C14 H20 N2 O2 |
Name | (1~{R},9~{S})-5-(3-oxidanylpropyl)-7,11-diazatricyclo[7.3.1.0^{2,7}]trideca-2,4-dien-6-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6t9r Chain JJJ Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|